What is the molecular formula of Amino acid hydroxamates L-arginine hydroxamate hydrochloride?
The molecular formula is C6H16ClN5O2.
What are the synonyms of Amino acid hydroxamates L-arginine hydroxamate hydrochloride?
The synonyms are (2R)-2-amino-5-(diaminomethylideneamino)-N-hydroxypentanamide; hydrochloride and (R,Z)-2-amino-5-guanidino-N-hydroxypentanimidic acid hydrochloride.
What is the molecular weight of Amino acid hydroxamates L-arginine hydroxamate hydrochloride?
The molecular weight is 225.68 g/mol.
What is the IUPAC name of Amino acid hydroxamates L-arginine hydroxamate hydrochloride?
The IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)-N-hydroxypentanamide; hydrochloride.
What is the InChI of Amino acid hydroxamates L-arginine hydroxamate hydrochloride?
The InChI is InChI=1S/C6H15N5O2.ClH/c7-4(5(12)11-13)2-1-3-10-6(8)9;/h4,13H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m1./s1.
What is the Canonical SMILES of Amino acid hydroxamates L-arginine hydroxamate hydrochloride?
The Canonical SMILES is C(CC(C(=O)NO)N)CN=C(N)N.Cl.
How many hydrogen bond donor counts does Amino acid hydroxamates L-arginine hydroxamate hydrochloride have?
It has 6 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Amino acid hydroxamates L-arginine hydroxamate hydrochloride have?
It has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Amino acid hydroxamates L-arginine hydroxamate hydrochloride have?
It has 5 rotatable bond counts.
Is Amino acid hydroxamates L-arginine hydroxamate hydrochloride a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.