What is the PubChem CID for allyl oxalyl chloride?
The PubChem CID for allyl oxalyl chloride is 3018516.
What is the molecular formula of allyl oxalyl chloride?
The molecular formula of allyl oxalyl chloride is C5H5ClO3.
What is the molecular weight of allyl oxalyl chloride?
The molecular weight of allyl oxalyl chloride is 148.54 g/mol.
What is the IUPAC name of allyl oxalyl chloride?
The IUPAC name of allyl oxalyl chloride is prop-2-enyl 2-chloro-2-oxoacetate.
What is the InChI of allyl oxalyl chloride?
The InChI of allyl oxalyl chloride is InChI=1S/C5H5ClO3/c1-2-3-9-5(8)4(6)7/h2H,1,3H2.
What is the InChIKey of allyl oxalyl chloride?
The InChIKey of allyl oxalyl chloride is HNOLIWBAJVIBOU-UHFFFAOYSA-N.
What is the canonical SMILES of allyl oxalyl chloride?
The canonical SMILES of allyl oxalyl chloride is C=CCOC(=O)C(=O)Cl.
What is the CAS number of allyl oxalyl chloride?
The CAS number of allyl oxalyl chloride is 74503-07-4.
What is the European Community (EC) number of allyl oxalyl chloride?
The European Community (EC) number of allyl oxalyl chloride is 277-900-7.
Is allyl oxalyl chloride a canonicalized compound?
Yes, allyl oxalyl chloride is a canonicalized compound.