What is the molecular formula of Alizarin Rubinol R?
The molecular formula of Alizarin Rubinol R is C24H17N2NaO5S.
What is the molecular weight of Alizarin Rubinol R?
The molecular weight of Alizarin Rubinol R is 468.5 g/mol.
What is the IUPAC name of Alizarin Rubinol R?
The IUPAC name of Alizarin Rubinol R is sodium;5-methyl-2-[(14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.0 2,7 .0 13,17 ]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]benzenesulfonate.
What is the InChI of Alizarin Rubinol R?
The InChI of Alizarin Rubinol R is InChI=1S/C24H18N2O5S.Na/c1-13-7-8-17(20(11-13)32(29,30)31)25-18-9-10-19-22-16(12-21(27)26(19)2)14-5-3-4-6-15(14)24(28)23(18)22;/h3-12,25H,1-2H3,(H,29,30,31);/q;+1/p-1.
What is the InChIKey of Alizarin Rubinol R?
The InChIKey of Alizarin Rubinol R is RNTNZRPCYDDMIA-UHFFFAOYSA-M.
What is the canonical SMILES of Alizarin Rubinol R?
The canonical SMILES of Alizarin Rubinol R is CC1=CC(=C(C=C1)NC2=C3C4=C(C=C2)N(C(=O)C=C4C5=CC=CC=C5C3=O)C)S(=O)(=O)[O-].[Na+].
What is the CAS number of Alizarin Rubinol R?
The CAS number of Alizarin Rubinol R is 4478-76-6.
What is the EC number of Alizarin Rubinol R?
The EC number of Alizarin Rubinol R is 224-759-4.
What is the DSSTox Substance ID of Alizarin Rubinol R?
The DSSTox Substance ID of Alizarin Rubinol R is DTXSID50884074.
Is Alizarin Rubinol R a canonicalized compound?
Yes, Alizarin Rubinol R is a canonicalized compound according to PubChem.
How many hydrogen bond donor counts are there in ALIZARIN RUBINOL R?
ALIZARIN RUBINOL R has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in ALIZARIN RUBINOL R?
ALIZARIN RUBINOL R has 6 hydrogen bond acceptor counts.