What is the molecular formula of adefovir dipivoxil?
The molecular formula of adefovir dipivoxil is C20H32N5O8P.
What is the molecular weight of adefovir dipivoxil?
The molecular weight of adefovir dipivoxil is 501.5 g/mol.
What is the IUPAC name of adefovir dipivoxil?
The IUPAC name of adefovir dipivoxil is [2-(6-aminopurin-9-yl)ethoxymethyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
What is the InChI of adefovir dipivoxil?
The InChI of adefovir dipivoxil is InChI=1S/C20H32N5O8P/c1-19(2,3)17(26)30-11-32-34(28,33-12-31-18(27)20(4,5)6)13-29-8-7-25-10-24-14-15(21)22-9-23-16(14)25/h9-10H,7-8,11-13H2,1-6H3,(H2,21,22,23).
What is the InChIKey of adefovir dipivoxil?
The InChIKey of adefovir dipivoxil is WOZSCQDILHKSGG-UHFFFAOYSA-N.
What is the canonical SMILES of adefovir dipivoxil?
The canonical SMILES of adefovir dipivoxil is CC(C)(C)C(=O)OCOP(=O)(COCCN1C=NC2=C(N=CN=C21)N)OCOC(=O)C(C)(C)C.
What is the CAS number of adefovir dipivoxil?
The CAS number of adefovir dipivoxil is 142340-99-6.
What is the ChEMBL ID of adefovir dipivoxil?
The ChEMBL ID of adefovir dipivoxil is CHEMBL922.
What is the UNII of adefovir dipivoxil?
The UNII of adefovir dipivoxil is U6Q8Z01514.
What is the Nikkaji Number of adefovir dipivoxil?
The Nikkaji Number of adefovir dipivoxil is J592.477D.