What is the PubChem CID of Acid Orange 127?
PubChem CID 23688093.
What is the molecular formula of Acid Orange 127?
The molecular formula is C24H19N4NaO4S.
What are the synonyms of Acid Orange 127?
The synonyms are 72765-52-7, 12269-96-4, SODIUM 3-[[4-[(4-ETHOXYPHENYL)AZO]-1-NAPHTHYL]AZO]BENZENESULPHONATE, Acid orange 127 (C.I. 26502), sodium;3-[[4-[(4-ethoxyphenyl)diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonate.
What is the molecular weight of Acid Orange 127?
The molecular weight is 482.5 g/mol.
What is the IUPAC name of Acid Orange 127?
The IUPAC name is sodium;3-[[4-[(4-ethoxyphenyl)diazenyl]naphthalen-1-yl]diazenyl]benzenesulfonate.
What is the InChI of Acid Orange 127?
The InChI is InChI=1S/C24H20N4O4S.Na/c1-2-32-19-12-10-17(11-13-19)25-27-23-14-15-24(22-9-4-3-8-21(22)23)28-26-18-6-5-7-20(16-18)33(29,30)31;/h3-16H,2H2,1H3,(H,29,30,31);/q;+1/p-1.
What is the InChIKey of Acid Orange 127?
The InChIKey is FTYDFSDLKHVWLD-UHFFFAOYSA-M.
What is the canonical SMILES of Acid Orange 127?
The canonical SMILES is CCOC1=CC=C(C=C1)N=NC2=CC=C(C3=CC=CC=C32)N=NC4=CC(=CC=C4)S(=O)(=O)[O-].[Na+].
What is the CAS number of Acid Orange 127?
The CAS number is 72765-52-7.
What is the hydrogen bond donor count of Acid Orange 127?
The hydrogen bond donor count of Acid Orange 127 is 0.
What is the hydrogen bond acceptor count of Acid Orange 127?
The hydrogen bond acceptor count of Acid Orange 127 is 8.