What is the molecular formula of Acetyl Tetrapeptide-9?
The molecular formula of Acetyl Tetrapeptide-9 is C22H33N7O9.
What is the molecular weight of Acetyl Tetrapeptide-9?
The molecular weight of Acetyl Tetrapeptide-9 is 539.5 g/mol.
When was Acetyl Tetrapeptide-9 created and modified?
Acetyl Tetrapeptide-9 was created on 2006-10-26 and modified on 2023-12-30.
What is the IUPAC name of Acetyl Tetrapeptide-9?
The IUPAC name of Acetyl Tetrapeptide-9 is (3S)-3-[[(2S)-2-acetamido-5-amino-5-oxopentanoyl]amino]-4-[[(2S)-1-[[(1S)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
What is the Canonical SMILES of Acetyl Tetrapeptide-9?
The Canonical SMILES of Acetyl Tetrapeptide-9 is CC(C)C(C(=O)NC(CC1=CN=CN1)C(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CCC(=O)N)NC(=O)C.
What is the InChIKey of Acetyl Tetrapeptide-9?
The InChIKey of Acetyl Tetrapeptide-9 is QNZANUZIBYJBIN-XSWJXKHESA-N.
What is the CAS number of Acetyl Tetrapeptide-9?
The CAS number of Acetyl Tetrapeptide-9 is 928006-50-2.
What is the XLogP3-AA value of Acetyl Tetrapeptide-9?
The XLogP3-AA value of Acetyl Tetrapeptide-9 is -2.5.
How many hydrogen bond donor counts does Acetyl Tetrapeptide-9 have?
Acetyl Tetrapeptide-9 has 8 hydrogen bond donor counts.
What is the topological polar surface area of Acetyl Tetrapeptide-9?
The topological polar surface area of Acetyl Tetrapeptide-9 is 263 Ų.