What is the molecular formula of 9-Ethynylphenanthrene?
The molecular formula of 9-Ethynylphenanthrene is C16H10.
What is the molecular weight of 9-Ethynylphenanthrene?
The molecular weight of 9-Ethynylphenanthrene is 202.25 g/mol.
What is the IUPAC name of 9-Ethynylphenanthrene?
The IUPAC name of 9-Ethynylphenanthrene is 9-ethynylphenanthrene.
What is the InChI of 9-Ethynylphenanthrene?
The InChI of 9-Ethynylphenanthrene is InChI=1S/C16H10/c1-2-12-11-13-7-3-4-9-15(13)16-10-6-5-8-14(12)16/h1,3-11H.
What is the InChIKey of 9-Ethynylphenanthrene?
The InChIKey of 9-Ethynylphenanthrene is FMKVRRYQWWPOAL-UHFFFAOYSA-N.
What is the canonical SMILES of 9-Ethynylphenanthrene?
The canonical SMILES of 9-Ethynylphenanthrene is C#CC1=CC2=CC=CC=C2C3=CC=CC=C31.
What is the CAS number of 9-Ethynylphenanthrene?
The CAS number of 9-Ethynylphenanthrene is 32870-98-7.
What is the ChEMBL ID of 9-Ethynylphenanthrene?
The ChEMBL ID of 9-Ethynylphenanthrene is CHEMBL1908227.
What is the XLogP3-AA value of 9-Ethynylphenanthrene?
The XLogP3-AA value of 9-Ethynylphenanthrene is 4.7.
Is 9-Ethynylphenanthrene a canonicalized compound?
Yes, 9-Ethynylphenanthrene is a canonicalized compound.