What is the molecular formula of 9-Bromo-julolidine?
The molecular formula of 9-Bromo-julolidine is C12H14BrN.
What is the molecular weight of 9-Bromo-julolidine?
The molecular weight of 9-Bromo-julolidine is 252.15 g/mol.
What is the IUPAC name of 9-Bromo-julolidine?
The IUPAC name of 9-Bromo-julolidine is 7-bromo-1-azatricyclo[7.3.1.0 5,13 ]trideca-5,7,9(13)-triene.
What is the InChI of 9-Bromo-julolidine?
The InChI of 9-Bromo-julolidine is "InChI=1S/C12H14BrN/c13-11-7-9-3-1-5-14-6-2-4-10(8-11)12(9)14/h7-8H,1-6H2".
What is the InChIKey of 9-Bromo-julolidine?
The InChIKey of 9-Bromo-julolidine is "PVTRKHJBWSTNOI-UHFFFAOYSA-N".
What is the Canonical SMILES of 9-Bromo-julolidine?
The Canonical SMILES of 9-Bromo-julolidine is "C1CC2=CC(=CC3=C2N(C1)CCC3)Br".
What is the CAS number of 9-Bromo-julolidine?
The CAS number of 9-Bromo-julolidine is 70173-54-5.
What is the European Community (EC) number of 9-Bromo-julolidine?
The European Community (EC) number of 9-Bromo-julolidine is 800-763-7.
What is the DSSTox Substance ID of 9-Bromo-julolidine?
The DSSTox Substance ID of 9-Bromo-julolidine is DTXSID20373703.
Is 9-Bromo-julolidine a canonicalized compound?
Yes, 9-Bromo-julolidine is a canonicalized compound according to PubChem.