What is the molecular formula of 9,10-Dimethylanthracene?
The molecular formula of 9,10-Dimethylanthracene is C16H14.
What is the molecular weight of 9,10-Dimethylanthracene?
The molecular weight of 9,10-Dimethylanthracene is 206.28 g/mol.
What is the IUPAC name of 9,10-Dimethylanthracene?
The IUPAC name of 9,10-Dimethylanthracene is 9,10-dimethylanthracene.
What is the InChI of 9,10-Dimethylanthracene?
The InChI of 9,10-Dimethylanthracene is InChI=1S/C16H14/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-10H,1-2H3.
What is the InChIKey of 9,10-Dimethylanthracene?
The InChIKey of 9,10-Dimethylanthracene is JTGMTYWYUZDRBK-UHFFFAOYSA-N.
What is the canonical SMILES of 9,10-Dimethylanthracene?
The canonical SMILES of 9,10-Dimethylanthracene is CC1=C2C=CC=CC2=C(C3=CC=CC=C13)C.
What is the CAS number of 9,10-Dimethylanthracene?
The CAS number of 9,10-Dimethylanthracene is 781-43-1.
How many hydrogen bond donor count does 9,10-Dimethylanthracene have?
9,10-Dimethylanthracene has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does 9,10-Dimethylanthracene have?
9,10-Dimethylanthracene has 0 hydrogen bond acceptor count.