What is the molecular formula of 9,10-Dihydrophenanthrene?
The molecular formula of 9,10-Dihydrophenanthrene is C14H12.
What is the molecular weight of 9,10-Dihydrophenanthrene?
The molecular weight of 9,10-Dihydrophenanthrene is 180.24 g/mol.
What is the IUPAC name of 9,10-Dihydrophenanthrene?
The IUPAC name of 9,10-Dihydrophenanthrene is 9,10-dihydrophenanthrene.
What is the InChI of 9,10-Dihydrophenanthrene?
The InChI of 9,10-Dihydrophenanthrene is InChI=1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-8H,9-10H2.
What is the InChIKey of 9,10-Dihydrophenanthrene?
The InChIKey of 9,10-Dihydrophenanthrene is XXPBFNVKTVJZKF-UHFFFAOYSA-N.
What is the canonical SMILES representation of 9,10-Dihydrophenanthrene?
The canonical SMILES representation of 9,10-Dihydrophenanthrene is C1CC2=CC=CC=C2C3=CC=CC=C31.
What is the CAS number of 9,10-Dihydrophenanthrene?
The CAS number of 9,10-Dihydrophenanthrene is 776-35-2.
What is the European Community (EC) number of 9,10-Dihydrophenanthrene?
The European Community (EC) number of 9,10-Dihydrophenanthrene is 212-278-2.
What is the UNII of 9,10-Dihydrophenanthrene?
The UNII of 9,10-Dihydrophenanthrene is BRM9TU2F34.