What is the PubChem CID of 8-Quinolineboronic acid?
PubChem CID 2734380.
What is the molecular formula of 8-Quinolineboronic acid?
The molecular formula is C9H8BNO2.
What is the molecular weight of 8-Quinolineboronic acid?
The molecular weight is 172.98 g/mol.
What is the IUPAC name of 8-Quinolineboronic acid?
The IUPAC name is quinolin-8-ylboronic acid.
What is the InChI of 8-Quinolineboronic acid?
The InChI of 8-Quinolineboronic acid is InChI=1S/C9H8BNO2/c12-10(13)8-5-1-3-7-4-2-6-11-9(7)8/h1-6,12-13H.
What is the InChIKey of 8-Quinolineboronic acid?
The InChIKey of 8-Quinolineboronic acid is KXJJSKYICDAICD-UHFFFAOYSA-N.
What is the canonical SMILES of 8-Quinolineboronic acid?
The canonical SMILES of 8-Quinolineboronic acid is B(C1=C2C(=CC=C1)C=CC=N2)(O)O.
What is the CAS number of 8-Quinolineboronic acid?
The CAS number is 86-58-8.
How many hydrogen bond donor counts does 8-Quinolineboronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 8-Quinolineboronic acid have?
It has 3 hydrogen bond acceptor counts.