What is the molecular formula of 8,8-Diapocarotenedioic acid?
The molecular formula of 8,8-Diapocarotenedioic acid is C20H24O4.
What is the molecular weight of 8,8-Diapocarotenedioic acid?
The molecular weight of 8,8-Diapocarotenedioic acid is 328.4 g/mol.
What are some synonyms of 8,8-Diapocarotenedioic acid?
Some synonyms of 8,8-Diapocarotenedioic acid include Crocetin, Transcrocetin, trans-Crocetin, and Crocetin(2-).
What is the IUPAC name of 8,8-Diapocarotenedioic acid?
The IUPAC name of 8,8-Diapocarotenedioic acid is (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid.
What is the InChI of 8,8-Diapocarotenedioic acid?
The InChI of 8,8-Diapocarotenedioic acid is InChI=1S/C20H24O4/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24/h5-14H,1-4H3,(H,21,22)(H,23,24)/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+.
What is the InChIKey of 8,8-Diapocarotenedioic acid?
The InChIKey of 8,8-Diapocarotenedioic acid is PANKHBYNKQNAHN-MQQNZMFNSA-N.
What is the canonical SMILES of 8,8-Diapocarotenedioic acid?
The canonical SMILES of 8,8-Diapocarotenedioic acid is CC(=CC=CC=C(C)C=CC=C(C)C(=O)O)C=CC=C(C)C(=O)O.
What is the CAS number of 8,8-Diapocarotenedioic acid?
The CAS number of 8,8-Diapocarotenedioic acid is 27876-94-4.
How many rotatable bonds are present in 8,8-Diapocarotenedioic acid?
There are 8 rotatable bonds present in 8,8-Diapocarotenedioic acid.
What is the exact mass of 8,8-Diapocarotenedioic acid?
The exact mass of 8,8-Diapocarotenedioic acid is 328.16745924 g/mol.