What is the molecular formula of 7-Methylbenzo[a]pyrene?
The molecular formula of 7-Methylbenzo[a]pyrene is C21H14.
What is the molecular weight of 7-Methylbenzo[a]pyrene?
The molecular weight of 7-Methylbenzo[a]pyrene is 266.3 g/mol.
How is the IUPAC name of 7-Methylbenzo[a]pyrene computed?
The IUPAC name of 7-Methylbenzo[a]pyrene is computed by Lexichem TK 2.7.0.
What is the InChI of 7-Methylbenzo[a]pyrene?
The InChI of 7-Methylbenzo[a]pyrene is InChI=1S/C21H14/c1-13-4-2-7-17-18-11-10-15-6-3-5-14-8-9-16(12-19(13)17)21(18)20(14)15/h2-12H,1H3.
What is the InChIKey of 7-Methylbenzo[a]pyrene?
The InChIKey of 7-Methylbenzo[a]pyrene is PYVWGNPFWVQISD-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Methylbenzo[a]pyrene?
The canonical SMILES of 7-Methylbenzo[a]pyrene is CC1=C2C=C3C=CC4=C5C3=C(C2=CC=C1)C=CC5=CC=C4.
What is the CAS number of 7-Methylbenzo[a]pyrene?
The CAS number of 7-Methylbenzo[a]pyrene is 63041-77-0.
What is the European Community (EC) number of 7-Methylbenzo[a]pyrene?
The European Community (EC) number of 7-Methylbenzo[a]pyrene is 633-111-3.
What is the UNII of 7-Methylbenzo[a]pyrene?
The UNII of 7-Methylbenzo[a]pyrene is 6J4BS15OLB.