What is the molecular formula of 7-Methoxy-2-tetralone?
The molecular formula of 7-Methoxy-2-tetralone is C11H12O2.
What is the molecular weight of 7-Methoxy-2-tetralone?
The molecular weight of 7-Methoxy-2-tetralone is 176.21 g/mol.
What is the IUPAC name of 7-Methoxy-2-tetralone?
The IUPAC name of 7-Methoxy-2-tetralone is 7-methoxy-3,4-dihydro-1H-naphthalen-2-one.
What is the InChI of 7-Methoxy-2-tetralone?
The InChI of 7-Methoxy-2-tetralone is InChI=1S/C11H12O2/c1-13-11-5-3-8-2-4-10(12)6-9(8)7-11/h3,5,7H,2,4,6H2,1H3.
What is the InChIKey of 7-Methoxy-2-tetralone?
The InChIKey of 7-Methoxy-2-tetralone is XEAPZXNZOJGVCZ-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Methoxy-2-tetralone?
The canonical SMILES of 7-Methoxy-2-tetralone is COC1=CC2=C(CCC(=O)C2)C=C1.
What is the CAS number of 7-Methoxy-2-tetralone?
The CAS number of 7-Methoxy-2-tetralone is 4133-34-0.
What is the European Community (EC) number of 7-Methoxy-2-tetralone?
The European Community (EC) number of 7-Methoxy-2-tetralone is 223-954-1.
What is the UNII of 7-Methoxy-2-tetralone?
The UNII of 7-Methoxy-2-tetralone is WF978B639S.
Is 7-Methoxy-2-tetralone a canonicalized compound?
Yes, 7-Methoxy-2-tetralone is a canonicalized compound.