What is the molecular formula of 7-Bromoisatin?
The molecular formula of 7-Bromoisatin is C8H4BrNO2.
What is the molecular weight of 7-Bromoisatin?
The molecular weight of 7-Bromoisatin is 226.03 g/mol.
What is the IUPAC name of 7-Bromoisatin?
The IUPAC name of 7-Bromoisatin is 7-bromo-1H-indole-2,3-dione.
What is the InChI of 7-Bromoisatin?
The InChI of 7-Bromoisatin is InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12).
What is the InChIKey of 7-Bromoisatin?
The InChIKey of 7-Bromoisatin is OCVKSIWBTJCXPV-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromoisatin?
The canonical SMILES of 7-Bromoisatin is C1=CC2=C(C(=C1)Br)NC(=O)C2=O.
What is the CAS number of 7-Bromoisatin?
The CAS number of 7-Bromoisatin is 20780-74-9.
What is the European Community (EC) number of 7-Bromoisatin?
The European Community (EC) number of 7-Bromoisatin is 625-256-6.
What is the ChEMBL ID of 7-Bromoisatin?
The ChEMBL ID of 7-Bromoisatin is CHEMBL228239.
Is 7-Bromoisatin a canonicalized compound?
Yes, 7-Bromoisatin is a canonicalized compound.