What is the molecular formula of 7-Bromo-4-chromanone?
The molecular formula is C9H7BrO2.
What is the molecular weight of 7-Bromo-4-chromanone?
The molecular weight is 227.05 g/mol.
What are the synonyms of 7-Bromo-4-chromanone?
The synonyms include 7-Bromochroman-4-one, 18442-22-3, 7-BROMO-4-CHROMANONE, 7-bromo-chroman-4-one, and 7-bromo-2,3-dihydrochromen-4-one.
What is the IUPAC name of 7-Bromo-4-chromanone?
The IUPAC name is 7-bromo-2,3-dihydrochromen-4-one.
What is the InChI of 7-Bromo-4-chromanone?
The InChI is InChI=1S/C9H7BrO2/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-2,5H,3-4H2.
What is the InChIKey of 7-Bromo-4-chromanone?
The InChIKey is DMEAYYYHWLCPCD-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromo-4-chromanone?
The canonical SMILES is C1COC2=C(C1=O)C=CC(=C2)Br.
What is the CAS number of 7-Bromo-4-chromanone?
The CAS number is 18442-22-3.
What is the European Community (EC) number of 7-Bromo-4-chromanone?
The European Community (EC) number is 830-935-7.
Is 7-Bromo-4-chromanone a covalently-bonded unit?
Yes, 7-Bromo-4-chromanone is a covalently-bonded unit.