What is the molecular formula of 6-Keto cholestanol?
The molecular formula of 6-Keto cholestanol is C27H46O2.
What is the molecular weight of 6-Keto cholestanol?
The molecular weight of 6-Keto cholestanol is 402.7 g/mol.
What is the IUPAC name of 6-Keto cholestanol?
The IUPAC name of 6-Keto cholestanol is (3S,5S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
What is the InChI of 6-Keto cholestanol?
The InChI of 6-Keto cholestanol is InChI=1S/C27H46O2/c1-17(2)7-6-8-18(3)21-9-10-22-20-16-25(29)24-15-19(28)11-13-27(24,5)23(20)12-14-26(21,22)4/h17-24,28H,6-16H2,1-5H3/t18-,19+,20+,21-,22+,23+,24-,26-,27-/m1/s1.
What is the InChIKey of 6-Keto cholestanol?
The InChIKey of 6-Keto cholestanol is JQMQKOQOLPGBBE-ZNCJEFCDSA-N.
What is the canonical SMILES of 6-Keto cholestanol?
The canonical SMILES of 6-Keto cholestanol is CC(C)CCCC(C)C1CCC2C1(CCC3C2CC(=O)C4C3(CCC(C4)O)C).
What is the isomeric SMILES of 6-Keto cholestanol?
The isomeric SMILES of 6-Keto cholestanol is C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC(=O)[C@@H]4[C@@]3(CC[C@@H](C4)O)C).
What is the CAS number of 6-Keto cholestanol?
The CAS number of 6-Keto cholestanol is 1175-06-0.
What is the European Community Number of 6-Keto cholestanol?
The European Community Number of 6-Keto cholestanol is 214-640-5.
What is the ChEMBL ID of 6-Keto cholestanol?
The ChEMBL ID of 6-Keto cholestanol is CHEMBL2418990.