What is the molecular formula of 6-Isopropyl-O-toluidine?
The molecular formula is C10H15N.
What is the molecular weight of 6-Isopropyl-O-toluidine?
The molecular weight is 149.23 g/mol.
What is the IUPAC name of 6-Isopropyl-O-toluidine?
The IUPAC name is 2-methyl-6-propan-2-ylaniline.
What is the InChI of 6-Isopropyl-O-toluidine?
The InChI is InChI=1S/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3.
What is the InChIKey of 6-Isopropyl-O-toluidine?
The InChIKey is DDTKYVBFPULMGN-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Isopropyl-O-toluidine?
The canonical SMILES is CC1=C(C(=CC=C1)C(C)C)N.
What is the CAS number of 6-Isopropyl-O-toluidine?
The CAS number is 5266-85-3.
What is the European Community (EC) number of 6-Isopropyl-O-toluidine?
The European Community (EC) number is 226-083-5.
What is the UNII of 6-Isopropyl-O-toluidine?
The UNII is JS12FDL562.
What is the XLogP3 value of 6-Isopropyl-O-toluidine?
The XLogP3 value is 2.4.