What is the molecular formula of 6-Hydroxyhexyl acrylate?
The molecular formula of 6-Hydroxyhexyl acrylate is C9H16O3.
What is the molecular weight of 6-Hydroxyhexyl acrylate?
The molecular weight of 6-Hydroxyhexyl acrylate is 172.22 g/mol.
What is the IUPAC Name of 6-Hydroxyhexyl acrylate?
The IUPAC Name of 6-Hydroxyhexyl acrylate is 6-hydroxyhexyl prop-2-enoate.
What is the InChI of 6-Hydroxyhexyl acrylate?
The InChI of 6-Hydroxyhexyl acrylate is InChI=1S/C9H16O3/c1-2-9(11)12-8-6-4-3-5-7-10/h2,10H,1,3-8H2.
What is the InChIKey of 6-Hydroxyhexyl acrylate?
The InChIKey of 6-Hydroxyhexyl acrylate is OCIFJWVZZUDMRL-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Hydroxyhexyl acrylate?
The Canonical SMILES of 6-Hydroxyhexyl acrylate is C=CC(=O)OCCCCCCO.
What is the CAS number of 6-Hydroxyhexyl acrylate?
The CAS number of 6-Hydroxyhexyl acrylate is 10095-14-4.
What is the European Community (EC) Number of 6-Hydroxyhexyl acrylate?
The European Community (EC) Number of 6-Hydroxyhexyl acrylate is 233-227-0.
Is 6-Hydroxyhexyl acrylate a Canonicalized compound?
Yes, 6-Hydroxyhexyl acrylate is a Canonicalized compound.