What is the molecular formula of 6-Dehydrotestosterone Acetate?
The molecular formula of 6-Dehydrotestosterone Acetate is C19H26O2.
What are the synonyms of 6-Dehydrotestosterone Acetate?
The synonyms of 6-Dehydrotestosterone Acetate are 6-Dehydrotestosterone, 2484-30-2, 17beta-hydroxyandrosta-4,6-dien-3-one, 6,7-didehydrotestosterone, and 4P45K0O2LX.
What is the molecular weight of 6-Dehydrotestosterone Acetate?
The molecular weight of 6-Dehydrotestosterone Acetate is 286.4 g/mol.
What is the IUPAC name of 6-Dehydrotestosterone Acetate?
The IUPAC name of 6-Dehydrotestosterone Acetate is (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
What is the InChI of 6-Dehydrotestosterone Acetate?
The InChI of 6-Dehydrotestosterone Acetate is InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,11,14-17,21H,5-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1.
What is the InChIKey of 6-Dehydrotestosterone Acetate?
The InChIKey of 6-Dehydrotestosterone Acetate is UMDCOKNNLDEKJB-DYKIIFRCSA-N.
What is the Canonical SMILES of 6-Dehydrotestosterone Acetate?
The Canonical SMILES of 6-Dehydrotestosterone Acetate is CC12CCC3C(C1CCC2O)C=CC4=CC(=O)CCC34C.
What is the CAS number of 6-Dehydrotestosterone Acetate?
The CAS number of 6-Dehydrotestosterone Acetate is 2484-30-2.
What is the European Community (EC) number of 6-Dehydrotestosterone Acetate?
The European Community (EC) number of 6-Dehydrotestosterone Acetate is 219-623-6.
Is 6-Dehydrotestosterone Acetate a canonicalized compound?
Yes, 6-Dehydrotestosterone Acetate is a canonicalized compound.