What is the molecular formula of 6-Bromoisochroman-4-one?
The molecular formula of 6-Bromoisochroman-4-one is C9H7BrO2.
What is the molecular weight of 6-Bromoisochroman-4-one?
The molecular weight of 6-Bromoisochroman-4-one is 227.05 g/mol.
What is the IUPAC name of 6-Bromoisochroman-4-one?
The IUPAC name of 6-Bromoisochroman-4-one is 6-bromo-1H-isochromen-4-one.
What is the InChI of 6-Bromoisochroman-4-one?
The InChI of 6-Bromoisochroman-4-one is InChI=1S/C9H7BrO2/c10-7-2-1-6-4-12-5-9(11)8(6)3-7/h1-3H,4-5H2.
What is the InChIKey of 6-Bromoisochroman-4-one?
The InChIKey of 6-Bromoisochroman-4-one is KOROTCDTJPLXMA-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromoisochroman-4-one?
The canonical SMILES of 6-Bromoisochroman-4-one is C1C2=C(C=C(C=C2)Br)C(=O)CO1.
What is the CAS number of 6-Bromoisochroman-4-one?
The CAS number of 6-Bromoisochroman-4-one is 676134-68-2.
What is the XLogP3-AA value of 6-Bromoisochroman-4-one?
The XLogP3-AA value of 6-Bromoisochroman-4-one is 1.8.
How many hydrogen bond donor counts does 6-Bromoisochroman-4-one have?
6-Bromoisochroman-4-one has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 6-Bromoisochroman-4-one have?
6-Bromoisochroman-4-one has 2 hydrogen bond acceptor counts.