What is the molecular formula of 6-Bromo-2-naphthol?
The molecular formula of 6-Bromo-2-naphthol is C10H7BrO.
What is the molecular weight of 6-Bromo-2-naphthol?
The molecular weight of 6-Bromo-2-naphthol is 223.07 g/mol.
What is the IUPAC name of 6-Bromo-2-naphthol?
The IUPAC name of 6-Bromo-2-naphthol is 6-bromonaphthalen-2-ol.
What is the InChI of 6-Bromo-2-naphthol?
The InChI of 6-Bromo-2-naphthol is InChI=1S/C10H7BrO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6,12H.
What is the InChIKey of 6-Bromo-2-naphthol?
The InChIKey of 6-Bromo-2-naphthol is YLDFTMJPQJXGSS-UHFFFAOYSA-N.
What is the canonical SMILES representation of 6-Bromo-2-naphthol?
The canonical SMILES representation of 6-Bromo-2-naphthol is C1=CC2=C(C=CC(=C2)Br)C=C1O.
What is the CAS number of 6-Bromo-2-naphthol?
The CAS number of 6-Bromo-2-naphthol is 15231-91-1.
What is the molecular weight of 6-Bromo-2-naphthol according to PubChem?
The molecular weight of 6-Bromo-2-naphthol computed by PubChem is 223.07 g/mol.
How many hydrogen bond donor counts does 6-Bromo-2-naphthol have?
6-Bromo-2-naphthol has 1 hydrogen bond donor count.
What is the topological polar surface area of 6-Bromo-2-naphthol?
The topological polar surface area of 6-Bromo-2-naphthol is 20.2Ų.