What is the molecular formula of 5-Methyl-1-hexyne?
The molecular formula of 5-Methyl-1-hexyne is C7H12.
How much does 5-Methyl-1-hexyne weigh?
5-Methyl-1-hexyne weighs 96.17 g/mol.
What is the IUPAC name of 5-Methyl-1-hexyne?
The IUPAC name of 5-Methyl-1-hexyne is 5-methylhex-1-yne.
What is the InChI of 5-Methyl-1-hexyne?
The InChI of 5-Methyl-1-hexyne is InChI=1S/C7H12/c1-4-5-6-7(2)3/h1,7H,5-6H2,2-3H3.
What is the InChIKey of 5-Methyl-1-hexyne?
The InChIKey of 5-Methyl-1-hexyne is HKNANEMUCJGPMS-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Methyl-1-hexyne?
The canonical SMILES of 5-Methyl-1-hexyne is CC(C)CCC#C.
What is the CAS number of 5-Methyl-1-hexyne?
The CAS number of 5-Methyl-1-hexyne is 2203-80-7.
What is the European Community (EC) number of 5-Methyl-1-hexyne?
The European Community (EC) number of 5-Methyl-1-hexyne is 627-853-7.
What is the UNII of 5-Methyl-1-hexyne?
The UNII of 5-Methyl-1-hexyne is LRO6EA6HK1.
Is 5-Methyl-1-hexyne a canonicalized compound?
Yes, 5-Methyl-1-hexyne is a canonicalized compound.