What is the molecular formula of 5-Methoxyuridine?
The molecular formula of 5-Methoxyuridine is C10H14N2O7.
What is the molecular weight of 5-Methoxyuridine?
The molecular weight of 5-Methoxyuridine is 274.23 g/mol.
What is the IUPAC name of 5-Methoxyuridine?
The IUPAC name of 5-Methoxyuridine is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidine-2,4-dione.
What is the InChI of 5-Methoxyuridine?
The InChI of 5-Methoxyuridine is InChI=1S/C10H14N2O7/c1-18-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)19-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1.
What is the InChIKey of 5-Methoxyuridine?
The InChIKey of 5-Methoxyuridine is ZXIATBNUWJBBGT-JXOAFFINSA-N.
What are the synonyms of 5-Methoxyuridine?
The synonyms of 5-Methoxyuridine are Uridine, 5-methoxy-, mo(5)u, and 1-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-methoxypyrimidine-2,4(1H,3H)-dione.
What is the CAS number of 5-Methoxyuridine?
The CAS number of 5-Methoxyuridine is 35542-01-9.
What is the European Community (EC) Number of 5-Methoxyuridine?
The European Community (EC) Number of 5-Methoxyuridine is 252-609-8.
What is the XLogP3 value of 5-Methoxyuridine?
The XLogP3 value of 5-Methoxyuridine is -1.8.
How many hydrogen bond donor counts does 5-Methoxyuridine have?
5-Methoxyuridine has 4 hydrogen bond donor counts.