What is the molecular formula of 5-Hexyn-3-ol?
The molecular formula of 5-Hexyn-3-ol is C6H10O.
What is the molecular weight of 5-Hexyn-3-ol?
The molecular weight of 5-Hexyn-3-ol is 98.14 g/mol.
What is the IUPAC name of 5-Hexyn-3-ol?
The IUPAC name of 5-Hexyn-3-ol is hex-5-yn-3-ol.
What is the InChI of 5-Hexyn-3-ol?
The InChI of 5-Hexyn-3-ol is InChI=1S/C6H10O/c1-3-5-6(7)4-2/h1,6-7H,4-5H2,2H3.
What is the InChIKey of 5-Hexyn-3-ol?
The InChIKey of 5-Hexyn-3-ol is AJYGRAORQSCNED-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Hexyn-3-ol?
The canonical SMILES of 5-Hexyn-3-ol is CCC(CC#C)O.
What is the CAS number of 5-Hexyn-3-ol?
The CAS number of 5-Hexyn-3-ol is 19780-84-8.
What is the XLogP3-AA value of 5-Hexyn-3-ol?
The XLogP3-AA value of 5-Hexyn-3-ol is 1.1.
How many hydrogen bond donor counts does 5-Hexyn-3-ol have?
5-Hexyn-3-ol has 1 hydrogen bond donor count.
How many rotatable bond counts does 5-Hexyn-3-ol have?
5-Hexyn-3-ol has 2 rotatable bond counts.