What is the PubChem CID for 5-Formylindole?
The PubChem CID for 5-Formylindole is 589040.
What is the molecular formula of 5-Formylindole?
The molecular formula of 5-Formylindole is C9H7NO.
What are some synonyms for 5-Formylindole?
Some synonyms for 5-Formylindole are Indole-5-carboxaldehyde and 1H-Indole-5-carbaldehyde.
What is the molecular weight of 5-Formylindole?
The molecular weight of 5-Formylindole is 145.16 g/mol.
When was 5-Formylindole created?
5-Formylindole was created on March 27, 2005.
What is the IUPAC name of 5-Formylindole?
The IUPAC name of 5-Formylindole is 1H-indole-5-carbaldehyde.
What is the InChI of 5-Formylindole?
The InChI of 5-Formylindole is InChI=1S/C9H7NO/c11-6-7-1-2-9-8(5-7)3-4-10-9/h1-6,10H.
What is the InChIKey of 5-Formylindole?
The InChIKey of 5-Formylindole is ADZUEEUKBYCSEY-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Formylindole?
The Canonical SMILES of 5-Formylindole is C1=CC2=C(C=CN2)C=C1C=O.
Is 5-Formylindole a canonicalized compound?
Yes, 5-Formylindole is a canonicalized compound.