What is the molecular formula of 5-Fluoroindole?
The molecular formula of 5-Fluoroindole is C8H6FN.
What is the molecular weight of 5-Fluoroindole?
The molecular weight of 5-Fluoroindole is 135.14 g/mol.
What is the IUPAC name of 5-Fluoroindole?
The IUPAC name of 5-Fluoroindole is 5-fluoro-1H-indole.
What is the InChI of 5-Fluoroindole?
The InChI of 5-Fluoroindole is InChI=1S/C8H6FN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H.
What is the InChIKey of 5-Fluoroindole?
The InChIKey of 5-Fluoroindole is ODFFPRGJZRXNHZ-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Fluoroindole?
The canonical SMILES of 5-Fluoroindole is C1=CC2=C(C=CN2)C=C1F.
What is the CAS number of 5-Fluoroindole?
The CAS number of 5-Fluoroindole is 399-52-0.
What is the European Community (EC) number of 5-Fluoroindole?
The European Community (EC) number of 5-Fluoroindole is 206-917-4.
What is the ChEMBL ID of 5-Fluoroindole?
The ChEMBL ID of 5-Fluoroindole is CHEMBL555457.
What is the monoisotopic mass of 5-Fluoroindole?
The monoisotopic mass of 5-Fluoroindole is 135.048427358 g/mol.