What is the molecular formula of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The molecular formula of 5-Fluoro-2-methoxycarboxyphenylboronic acid is C8H8BFO4.
What are some synonyms for 5-Fluoro-2-methoxycarboxyphenylboronic acid?
Some synonyms for 5-Fluoro-2-methoxycarboxyphenylboronic acid include 2-Methoxycarbonyl-5-fluorophenylboronic acid, (5-fluoro-2-methoxycarbonylphenyl)boronic acid, and 5-FLUORO-2-METHOXYCARBOXYPHENYLBORONIC ACID.
What is the molecular weight of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The molecular weight of 5-Fluoro-2-methoxycarboxyphenylboronic acid is 197.96 g/mol.
When was 5-Fluoro-2-methoxycarboxyphenylboronic acid created?
5-Fluoro-2-methoxycarboxyphenylboronic acid was created on September 14, 2005.
What is the IUPAC name of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The IUPAC name of 5-Fluoro-2-methoxycarboxyphenylboronic acid is (5-fluoro-2-methoxycarbonylphenyl)boronic acid.
What is the InChI of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The InChI of 5-Fluoro-2-methoxycarboxyphenylboronic acid is InChI=1S/C8H8BFO4/c1-14-8(11)6-3-2-5(10)4-7(6)9(12)13/h2-4,12-13H,1H3.
What is the InChIKey of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The InChIKey of 5-Fluoro-2-methoxycarboxyphenylboronic acid is CHDCMVDJRAQCTJ-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The canonical SMILES of 5-Fluoro-2-methoxycarboxyphenylboronic acid is B(C1=C(C=CC(=C1)F)C(=O)OC)(O)O.
What is the CAS number of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The CAS number of 5-Fluoro-2-methoxycarboxyphenylboronic acid is 850568-05-7.
What is the European Community (EC) number of 5-Fluoro-2-methoxycarboxyphenylboronic acid?
The European Community (EC) number of 5-Fluoro-2-methoxycarboxyphenylboronic acid is 855-577-9.
※ Please kindly note that our products are for research use only.