What is the molecular formula of 5-Chloromethylfurfural?
The molecular formula of 5-Chloromethylfurfural is C6H5ClO2.
What is the molecular weight of 5-Chloromethylfurfural?
The molecular weight of 5-Chloromethylfurfural is 144.55 g/mol.
What is the IUPAC name of 5-Chloromethylfurfural?
The IUPAC name of 5-Chloromethylfurfural is 5-(chloromethyl)furan-2-carbaldehyde.
What is the InChI of 5-Chloromethylfurfural?
The InChI of 5-Chloromethylfurfural is InChI=1S/C6H5ClO2/c7-3-5-1-2-6(4-8)9-5/h1-2,4H,3H2.
What is the InChIKey of 5-Chloromethylfurfural?
The InChIKey of 5-Chloromethylfurfural is KAZRCBVXUOCTIO-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Chloromethylfurfural?
The canonical SMILES of 5-Chloromethylfurfural is C1=C(OC(=C1)C=O)CCl.
What is the CAS number of 5-Chloromethylfurfural?
The CAS number of 5-Chloromethylfurfural is 1623-88-7.
What is the European Community (EC) number of 5-Chloromethylfurfural?
The European Community (EC) number of 5-Chloromethylfurfural is 216-608-6.
What is the UNII of 5-Chloromethylfurfural?
The UNII of 5-Chloromethylfurfural is MXU4UQA8XG.
Is 5-Chloromethylfurfural a covalently-bonded unit?
Yes, 5-Chloromethylfurfural is a covalently-bonded unit.