What is the PubChem CID for 5-Chloro-7-iodo-8-quinolinol?
PubChem CID 2788
What is the molecular formula of 5-Chloro-7-iodo-8-quinolinol?
C9H5ClINO
What are some synonyms for 5-Chloro-7-iodo-8-quinolinol?
Clioquinol, Iodochlorhydroxyquin, Chinoform
What is the molecular weight of 5-Chloro-7-iodo-8-quinolinol?
305.50 g/mol
How is 5-Chloro-7-iodo-8-quinolinol described in terms of its physical properties?
Iodochlorohydroxyquinoline is a cream-colored to brownish-yellow powder. Practically odorless. Decomposes at 178-179 °C. Used as a topical anti-infective.
When was 5-Chloro-7-iodo-8-quinolinol created and last modified in the database?
Created on 2005-03-25, modified on 2023-12-30
What role does 5-Chloro-7-iodo-8-quinolinol play in terms of its properties?
It has a role as an antifungal agent, an antineoplastic agent, an antimicrobial agent, an antibacterial agent, a chelator, an antiprotozoal drug, and a copper chelator.
What is the InChIKey for 5-Chloro-7-iodo-8-quinolinol?
QCDFBFJGMNKBDO-UHFFFAOYSA-N
What is the Canonical SMILES representation of 5-Chloro-7-iodo-8-quinolinol?
C1=CC2=C(C(=C(C=C2Cl)I)O)N=C1
What are some other identifiers for 5-Chloro-7-iodo-8-quinolinol?
CAS number 130-26-7, UNII 7BHQ856EJ5, ChEMBL ID CHEMBL497, KEGG ID D03538, etc.
※ Please kindly note that our products are for research use only.