What is the molecular formula of 5-Chloro-2-nitroaniline?
The molecular formula of 5-Chloro-2-nitroaniline is C6H5ClN2O2.
What is the molecular weight of 5-Chloro-2-nitroaniline?
The molecular weight of 5-Chloro-2-nitroaniline is 172.57 g/mol.
What is the IUPAC name of 5-Chloro-2-nitroaniline?
The IUPAC name of 5-Chloro-2-nitroaniline is 5-chloro-2-nitroaniline.
What is the InChI of 5-Chloro-2-nitroaniline?
The InChI of 5-Chloro-2-nitroaniline is InChI=1S/C6H5ClN2O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H,8H2.
What is the InChIKey of 5-Chloro-2-nitroaniline?
The InChIKey of 5-Chloro-2-nitroaniline is ZCWXYZBQDNFULS-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Chloro-2-nitroaniline?
The canonical SMILES of 5-Chloro-2-nitroaniline is C1=CC(=C(C=C1Cl)N)[N+](=O)[O-].
What is the CAS number of 5-Chloro-2-nitroaniline?
The CAS number of 5-Chloro-2-nitroaniline is 1635-61-6.
What is the European Community (EC) Number of 5-Chloro-2-nitroaniline?
The European Community (EC) Number of 5-Chloro-2-nitroaniline is 216-661-5.
What is the UNII of 5-Chloro-2-nitroaniline?
The UNII of 5-Chloro-2-nitroaniline is 656XJM4CON.
Is 5-Chloro-2-nitroaniline a canonicalized compound?
Yes, 5-Chloro-2-nitroaniline is a canonicalized compound according to PubChem.