What is the molecular formula of 5-Carboxyvanillin?
The molecular formula of 5-Carboxyvanillin is C9H8O5.
What is the molecular weight of 5-Carboxyvanillin?
The molecular weight of 5-Carboxyvanillin is 196.16 g/mol.
What is the IUPAC name of 5-Carboxyvanillin?
The IUPAC name of 5-Carboxyvanillin is 5-formyl-2-hydroxy-3-methoxybenzoic acid.
What is the InChI of 5-Carboxyvanillin?
The InChI of 5-Carboxyvanillin is InChI=1S/C9H8O5/c1-14-7-3-5(4-10)2-6(8(7)11)9(12)13/h2-4,11H,1H3,(H,12,13).
What is the InChIKey of 5-Carboxyvanillin?
The InChIKey of 5-Carboxyvanillin is YFDQSVBNFNFXGF-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Carboxyvanillin?
The canonical SMILES of 5-Carboxyvanillin is COC1=CC(=CC(=C1O)C(=O)O).
What is the CAS number of 5-Carboxyvanillin?
The CAS number of 5-Carboxyvanillin is 3507-08-2.
What is the European Community (EC) number of 5-Carboxyvanillin?
The European Community (EC) number of 5-Carboxyvanillin is 222-504-1.
What is the UNII of 5-Carboxyvanillin?
The UNII of 5-Carboxyvanillin is HAB6WAR3X5.
Is 5-Carboxyvanillin a canonicalized compound?
Yes, 5-Carboxyvanillin is a canonicalized compound.