What is the PubChem CID of 5-Bromoquinoline?
PubChem CID: 817321
What is the molecular formula of 5-Bromoquinoline?
Molecular Formula: C9H6BrN
What is the molecular weight of 5-Bromoquinoline?
Molecular Weight: 208.05 g/mol
What is the IUPAC name of 5-Bromoquinoline?
IUPAC Name: 5-bromoquinoline
What is the InChI of 5-Bromoquinoline?
InChI: InChI=1S/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H
What is the InChIKey of 5-Bromoquinoline?
InChIKey: CHODTZCXWXCALP-UHFFFAOYSA-N
What is the canonical SMILES of 5-Bromoquinoline?
Canonical SMILES: C1=CC2=C(C=CC=N2)C(=C1)Br
What is the CAS number of 5-Bromoquinoline?
CAS Number: 4964-71-0
What is the European Community (EC) number of 5-Bromoquinoline?
EC Number: 639-373-5
Is 5-Bromoquinoline a canonicalized compound in PubChem?
Yes, 5-Bromoquinoline is canonicalized in PubChem.