What is the molecular formula of 5-Bromoquinazoline?
The molecular formula of 5-Bromoquinazoline is C8H5BrN2.
What is the molecular weight of 5-Bromoquinazoline?
The molecular weight of 5-Bromoquinazoline is 209.04 g/mol.
What is the IUPAC name of 5-Bromoquinazoline?
The IUPAC name of 5-Bromoquinazoline is 5-bromoquinazoline.
What is the InChI of 5-Bromoquinazoline?
The InChI of 5-Bromoquinazoline is InChI=1S/C8H5BrN2/c9-7-2-1-3-8-6(7)4-10-5-11-8/h1-5H.
What is the InChIKey of 5-Bromoquinazoline?
The InChIKey of 5-Bromoquinazoline is IAQNFOPKXLQOLR-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromoquinazoline?
The canonical SMILES of 5-Bromoquinazoline is C1=CC2=NC=NC=C2C(=C1)Br.
What is the CAS number of 5-Bromoquinazoline?
The CAS number of 5-Bromoquinazoline is 958452-00-1.
What is the XLogP3-AA value of 5-Bromoquinazoline?
The XLogP3-AA value of 5-Bromoquinazoline is 2.2.
What is the hydrogen bond donor count of 5-Bromoquinazoline?
The hydrogen bond donor count of 5-Bromoquinazoline is 0.
Is 5-Bromoquinazoline a canonicalized compound?
Yes, 5-Bromoquinazoline is a canonicalized compound.