What is the molecular formula of 5-bromoisoquinoline?
The molecular formula of 5-bromoisoquinoline is C9H6BrN.
What is the molecular weight of 5-bromoisoquinoline?
The molecular weight of 5-bromoisoquinoline is 208.05 g/mol.
When was 5-bromoisoquinoline created?
5-bromoisoquinoline was created on July 8, 2005.
When was 5-bromoisoquinoline last modified?
5-bromoisoquinoline was last modified on October 21, 2023.
What is the IUPAC name of 5-bromoisoquinoline?
The IUPAC name of 5-bromoisoquinoline is 5-bromoisoquinoline.
What is the InChI of 5-bromoisoquinoline?
The InChI of 5-bromoisoquinoline is InChI=1S/C9H6BrN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-6H.
What is the InChIKey of 5-bromoisoquinoline?
The InChIKey of 5-bromoisoquinoline is CYJZJGYYTFQQBY-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-bromoisoquinoline?
The Canonical SMILES of 5-bromoisoquinoline is C1=CC2=C(C=CN=C2)C(=C1)Br.
What is the CAS number of 5-bromoisoquinoline?
The CAS number of 5-bromoisoquinoline is 34784-04-8.
What is the XLogP3-AA value of 5-bromoisoquinoline?
The XLogP3-AA value of 5-bromoisoquinoline is 2.8.