What is the molecular formula of the compound identified by PubChem CID 45489804?
The molecular formula is C9H7BrO2.
What is another name for PubChem CID 45489804?
Another name for PubChem CID 45489804 is 5-Bromo-4-Chromanone.
What is the IUPAC name of PubChem CID 45489804?
The IUPAC name of PubChem CID 45489804 is 5-bromo-2,3-dihydrochromen-4-one.
What is the InChI of PubChem CID 45489804?
The InChI of PubChem CID 45489804 is InChI=1S/C9H7BrO2/c10-6-2-1-3-8-9(6)7(11)4-5-12-8/h1-3H,4-5H2.
What is the InChIKey of PubChem CID 45489804?
The InChIKey of PubChem CID 45489804 is ZZWQBLPTSSWLPE-UHFFFAOYSA-N.
What is the canonical SMILES of PubChem CID 45489804?
The canonical SMILES of PubChem CID 45489804 is C1COC2=C(C1=O)C(=CC=C2)Br.
What is the molecular weight of PubChem CID 45489804?
The molecular weight of PubChem CID 45489804 is 227.05 g/mol.
How many hydrogen bond donor counts does PubChem CID 45489804 have?
PubChem CID 45489804 has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does PubChem CID 45489804 have?
PubChem CID 45489804 has 2 hydrogen bond acceptor counts.
Is PubChem CID 45489804 a canonicalized compound?
Yes, PubChem CID 45489804 is a canonicalized compound.