What is the molecular formula of 5-Bromo-4,6-dihydroxypyrimidine?
The molecular formula of 5-Bromo-4,6-dihydroxypyrimidine is C4H3BrN2O2.
What are the synonyms for 5-Bromo-4,6-dihydroxypyrimidine?
The synonyms for 5-Bromo-4,6-dihydroxypyrimidine include 5-bromopyrimidine-4,6-diol, 5-Bromo-pyrimidine-4,6-diol, and 5-bromo-4-hydroxy-1H-pyrimidin-6-one.
What is the molecular weight of 5-Bromo-4,6-dihydroxypyrimidine?
The molecular weight of 5-Bromo-4,6-dihydroxypyrimidine is 190.98 g/mol.
When was 5-Bromo-4,6-dihydroxypyrimidine created and modified?
5-Bromo-4,6-dihydroxypyrimidine was created on 2005-09-18 and last modified on 2023-12-03.
What is the IUPAC Name of 5-Bromo-4,6-dihydroxypyrimidine?
The IUPAC Name of 5-Bromo-4,6-dihydroxypyrimidine is 5-bromo-4-hydroxy-1H-pyrimidin-6-one.
What is the InChI of 5-Bromo-4,6-dihydroxypyrimidine?
The InChI of 5-Bromo-4,6-dihydroxypyrimidine is InChI=1S/C4H3BrN2O2/c5-2-3(8)6-1-7-4(2)9/h1H,(H2,6,7,8,9).
What is the InChIKey of 5-Bromo-4,6-dihydroxypyrimidine?
The InChIKey of 5-Bromo-4,6-dihydroxypyrimidine is XVXHFPZMRQXGBM-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Bromo-4,6-dihydroxypyrimidine?
The Canonical SMILES of 5-Bromo-4,6-dihydroxypyrimidine is C1=NC(=C(C(=O)N1)Br)O.
What is the CAS number of 5-Bromo-4,6-dihydroxypyrimidine?
The CAS number of 5-Bromo-4,6-dihydroxypyrimidine is 15726-38-2.
What is the Monoisotopic Mass of 5-Bromo-4,6-dihydroxypyrimidine?
The Monoisotopic Mass of 5-Bromo-4,6-dihydroxypyrimidine is 189.93779 g/mol.
※ Please kindly note that our products are for research use only.