The molecular formula of the compound is C7H6BrN3.
What are some synonyms for the compound?
Some synonyms for the compound are 6-Bromo-1H-benzo[d]imidazol-7-amine, 1260883-50-8, 5-bromo-1H-benzimidazol-4-amine, and 5-Bromo-3H-benzo[d]imidazol-4-amine.
What is the molecular weight of the compound?
The molecular weight of the compound is 212.05 g/mol.
When was the compound created and last modified?
The compound was created on August 27, 2012, and last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-bromo-1H-benzimidazol-4-amine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H6BrN3/c8-4-1-2-5-7(6(4)9)11-3-10-5/h1-3H,9H2,(H,10,11).
What is the InChIKey of the compound?
The InChIKey of the compound is DHUKVHRPLYJHAM-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=C(C2=C1NC=N2)N)Br.
What is the CAS number of the compound?
The CAS number of the compound is 1260883-50-8.
Is the compound considered to be canonicalized?
Yes, the compound is considered to be canonicalized.
※ Please kindly note that our products are for research use only.