What is the molecular formula of 5-Bromo-3-formylpyridine?
The molecular formula of 5-Bromo-3-formylpyridine is C6H4BrNO.
What is the molecular weight of 5-Bromo-3-formylpyridine?
The molecular weight of 5-Bromo-3-formylpyridine is 186.01 g/mol.
What is the IUPAC name of 5-Bromo-3-formylpyridine?
The IUPAC name of 5-Bromo-3-formylpyridine is 5-bromopyridine-3-carbaldehyde.
What is the InChI code of 5-Bromo-3-formylpyridine?
The InChI code of 5-Bromo-3-formylpyridine is InChI=1S/C6H4BrNO/c7-6-1-5(4-9)2-8-3-6/h1-4H.
What is the InChIKey of 5-Bromo-3-formylpyridine?
The InChIKey of 5-Bromo-3-formylpyridine is NGUVGKAEOFPLDT-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-3-formylpyridine?
The canonical SMILES of 5-Bromo-3-formylpyridine is C1=C(C=NC=C1Br)C=O.
What is the CAS number of 5-Bromo-3-formylpyridine?
The CAS number of 5-Bromo-3-formylpyridine is 113118-81-3.
What is the EC number of 5-Bromo-3-formylpyridine?
The EC number of 5-Bromo-3-formylpyridine is 628-546-0.
What is the ChEMBL ID of 5-Bromo-3-formylpyridine?
The ChEMBL ID of 5-Bromo-3-formylpyridine is CHEMBL4440453.