What is the molecular weight of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The molecular weight of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is 312.18 g/mol.
What is the IUPAC name of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The IUPAC name of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate.
What is the InChI of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The InChI of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is InChI=1S/C12H10BrNO2S/c1-2-16-12(15)9-10(13)17-11(14-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3.
What is the InChIKey of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The InChIKey of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is ONAJVAODOMRERW-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The Canonical SMILES of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is CCOC(=O)C1=C(SC(=N1)C2=CC=CC=C2)Br.
What is the CAS number of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The CAS number of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is 914347-21-0.
What is the XLogP3-AA value of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester?
The XLogP3-AA value of 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester is 4.2.
How many hydrogen bond donor counts does 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester have?
5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester have?
5-Bromo-2-phenylthiazole-4-carboxylic acid ethyl ester has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.