What is the molecular formula of 5-Bromo-2-iodopyridine?
The molecular formula of 5-Bromo-2-iodopyridine is C5H3BrIN.
What is the molecular weight of 5-Bromo-2-iodopyridine?
The molecular weight of 5-Bromo-2-iodopyridine is 283.89 g/mol.
What is the IUPAC name of 5-Bromo-2-iodopyridine?
The IUPAC name of 5-Bromo-2-iodopyridine is 5-bromo-2-iodopyridine.
What is the InChI of 5-Bromo-2-iodopyridine?
The InChI of 5-Bromo-2-iodopyridine is InChI=1S/C5H3BrIN/c6-4-1-2-5(7)8-3-4/h1-3H.
What is the InChIKey of 5-Bromo-2-iodopyridine?
The InChIKey of 5-Bromo-2-iodopyridine is HSNBRDZXJMPDGH-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Bromo-2-iodopyridine?
The Canonical SMILES of 5-Bromo-2-iodopyridine is C1=CC(=NC=C1Br)I.
What is the CAS number of 5-Bromo-2-iodopyridine?
The CAS number of 5-Bromo-2-iodopyridine is 223463-13-6.
What is the heavy atom count of 5-Bromo-2-iodopyridine?
The heavy atom count of 5-Bromo-2-iodopyridine is 8.
What is the hydrogen bond donor count of 5-Bromo-2-iodopyridine?
The hydrogen bond donor count of 5-Bromo-2-iodopyridine is 0.
Is 5-Bromo-2-iodopyridine a canonicalized compound?
Yes, 5-Bromo-2-iodopyridine is a canonicalized compound according to PubChem.