What is the molecular formula of 5-Bromo-2-fluoroaniline?
The molecular formula of 5-Bromo-2-fluoroaniline is C6H5BrFN.
What is the molecular weight of 5-Bromo-2-fluoroaniline?
The molecular weight of 5-Bromo-2-fluoroaniline is 190.01 g/mol.
What is the IUPAC name of 5-Bromo-2-fluoroaniline?
The IUPAC name of 5-Bromo-2-fluoroaniline is 5-bromo-2-fluoroaniline.
What is the InChI of 5-Bromo-2-fluoroaniline?
The InChI of 5-Bromo-2-fluoroaniline is InChI=1S/C6H5BrFN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2.
What is the InChIKey of 5-Bromo-2-fluoroaniline?
The InChIKey of 5-Bromo-2-fluoroaniline is ADWKOCXRCRSMLQ-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-fluoroaniline?
The canonical SMILES of 5-Bromo-2-fluoroaniline is C1=CC(=C(C=C1Br)N)F.
What is the CAS number of 5-Bromo-2-fluoroaniline?
The CAS number of 5-Bromo-2-fluoroaniline is 2924-09-6.
What is the topological polar surface area of 5-Bromo-2-fluoroaniline?
The topological polar surface area of 5-Bromo-2-fluoroaniline is 26Ų.
Is 5-Bromo-2-fluoroaniline a canonicalized compound?
Yes, 5-Bromo-2-fluoroaniline is a canonicalized compound.