What is the molecular formula of 5-Bromo-2,4-difluorophenylamine?
The molecular formula of 5-Bromo-2,4-difluorophenylamine is C6H4BrF2N.
What are some synonyms of 5-Bromo-2,4-difluorophenylamine?
Some synonyms of 5-Bromo-2,4-difluorophenylamine are 5-Bromo-2,4-difluoroaniline, 2,4-Difluoro-5-bromo-phenylamine, and Benzenamine, 5-bromo-2,4-difluoro-.
What is the molecular weight of 5-Bromo-2,4-difluorophenylamine?
The molecular weight of 5-Bromo-2,4-difluorophenylamine is 208.00 g/mol.
When was 5-Bromo-2,4-difluorophenylamine created and modified?
5-Bromo-2,4-difluorophenylamine was created on July 19, 2005, and last modified on December 2, 2023.
What is the IUPAC name of 5-Bromo-2,4-difluorophenylamine?
The IUPAC name of 5-Bromo-2,4-difluorophenylamine is 5-bromo-2,4-difluoroaniline.
What is the InChI of 5-Bromo-2,4-difluorophenylamine?
The InChI of 5-Bromo-2,4-difluorophenylamine is InChI=1S/C6H4BrF2N/c7-3-1-6(10)5(9)2-4(3)8/h1-2H,10H2.
What is the InChIKey of 5-Bromo-2,4-difluorophenylamine?
The InChIKey of 5-Bromo-2,4-difluorophenylamine is FQZCUAASVCIWSL-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Bromo-2,4-difluorophenylamine?
The Canonical SMILES of 5-Bromo-2,4-difluorophenylamine is C1=C(C(=CC(=C1Br)F)F)N.
What is the XLogP3-AA of 5-Bromo-2,4-difluorophenylamine?
The XLogP3-AA of 5-Bromo-2,4-difluorophenylamine is 2.1.
How many hydrogen bond donor count does 5-Bromo-2,4-difluorophenylamine have?
5-Bromo-2,4-difluorophenylamine has one hydrogen bond donor count.
※ Please kindly note that our products are for research use only.