What is the PubChem CID of 5-Bromo-1-indanone?
The PubChem CID of 5-Bromo-1-indanone is 520695.
What is the molecular formula of 5-Bromo-1-indanone?
The molecular formula of 5-Bromo-1-indanone is C9H7BrO.
What is the molecular weight of 5-Bromo-1-indanone?
The molecular weight of 5-Bromo-1-indanone is 211.05 g/mol.
What is the IUPAC Name of 5-Bromo-1-indanone?
The IUPAC Name of 5-Bromo-1-indanone is 5-bromo-2,3-dihydroinden-1-one.
What is the Canonical SMILES of 5-Bromo-1-indanone?
The Canonical SMILES of 5-Bromo-1-indanone is C1CC(=O)C2=C1C=C(C=C2)Br.
What is the CAS number of 5-Bromo-1-indanone?
The CAS number of 5-Bromo-1-indanone is 34598-49-7.
What is the XLogP3-AA value of 5-Bromo-1-indanone?
The XLogP3-AA value of 5-Bromo-1-indanone is 2.4.
How many hydrogen bond donor counts does 5-Bromo-1-indanone have?
5-Bromo-1-indanone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 5-Bromo-1-indanone have?
5-Bromo-1-indanone has 1 hydrogen bond acceptor count.
How many rotatable bond counts does 5-Bromo-1-indanone have?
5-Bromo-1-indanone has 0 rotatable bond counts.