What is the PubChem CID for 5-Amino-2-bromopyridine?
The PubChem CID for 5-Amino-2-bromopyridine is 642811.
What is the molecular formula of 5-Amino-2-bromopyridine?
The molecular formula of 5-Amino-2-bromopyridine is C5H5BrN2.
What are the synonyms of 5-Amino-2-bromopyridine?
The synonyms of 5-Amino-2-bromopyridine include 13534-97-9, 3-Amino-6-bromopyridine, 6-bromopyridin-3-amine, and 2-bromo-5-aminopyridine.
What is the molecular weight of 5-Amino-2-bromopyridine?
The molecular weight of 5-Amino-2-bromopyridine is 173.01 g/mol.
What is the IUPAC name of 5-Amino-2-bromopyridine?
The IUPAC name of 5-Amino-2-bromopyridine is 6-bromopyridin-3-amine.
What is the InChI of 5-Amino-2-bromopyridine?
The InChI of 5-Amino-2-bromopyridine is InChI=1S/C5H5BrN2/c6-5-2-1-4(7)3-8-5/h1-3H,7H2.
What is the InChIKey of 5-Amino-2-bromopyridine?
The InChIKey of 5-Amino-2-bromopyridine is XTHKRYHULUJQHN-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Amino-2-bromopyridine?
The canonical SMILES of 5-Amino-2-bromopyridine is C1=CC(=NC=C1N)Br.
What is the CAS number of 5-Amino-2-bromopyridine?
The CAS number of 5-Amino-2-bromopyridine is 13534-97-9.
What is the molecular weight of 5-Amino-2-bromopyridine according to PubChem?
The molecular weight of 5-Amino-2-bromopyridine is 173.01 g/mol according to PubChem.