What is the molecular formula of 5-Acetylsalicylic acid?
The molecular formula of 5-Acetylsalicylic acid is C9H8O4.
What is the molecular weight of 5-Acetylsalicylic acid?
The molecular weight of 5-Acetylsalicylic acid is 180.16 g/mol.
What is the IUPAC name of 5-Acetylsalicylic acid?
The IUPAC name of 5-Acetylsalicylic acid is 5-acetyl-2-hydroxybenzoic acid.
What is the InChIKey of 5-Acetylsalicylic acid?
The InChIKey of 5-Acetylsalicylic acid is NZRDKNBIPVLNHA-UHFFFAOYSA-N.
What is the Canonical SMILES of 5-Acetylsalicylic acid?
The Canonical SMILES of 5-Acetylsalicylic acid is CC(=O)C1=CC(=C(C=C1)O)C(=O)O.
What is the CAS number of 5-Acetylsalicylic acid?
The CAS number of 5-Acetylsalicylic acid is 13110-96-8.
What is the EC number of 5-Acetylsalicylic acid?
The EC number of 5-Acetylsalicylic acid is 236-037-6.
What is the ChEMBL ID of 5-Acetylsalicylic acid?
The ChEMBL ID of 5-Acetylsalicylic acid is CHEMBL3765165.
What is the XLogP3 value of 5-Acetylsalicylic acid?
The XLogP3 value of 5-Acetylsalicylic acid is 2.2.
Is 5-Acetylsalicylic acid a canonical form of the compound?
Yes, 5-Acetylsalicylic acid is a canonical form of the compound.