5,6-Difluoro-1H-inden-2(3H)-one

• Catalog Number: ACM161712794
• Product Name: 5,6-Difluoro-1H-inden-2(3H)-one
• CAS: 161712-79-4
• Category: Heterocyclic Organic Compound
• Synonyms: 5,6-Difluoro-1H-inden-2(3H)-one;5,6-Difluoro-indan-2-one;2H-Inden-2-one, 5,6-difluoro-1,3-dihydro-
• Molecular Weight: 0

Custom Q&A

What is the molecular formula of 5,6-Difluoro-1H-inden-2(3H)-one?

The molecular formula is C9H6F2O.

What is the molecular weight of 5,6-Difluoro-1H-inden-2(3H)-one?

The molecular weight is 168.14 g/mol.

What is the IUPAC name of 5,6-Difluoro-1H-inden-2(3H)-one?

The IUPAC name is 5,6-difluoro-1,3-dihydroinden-2-one.

What is the InChI of 5,6-Difluoro-1H-inden-2(3H)-one?

The InChI is InChI=1S/C9H6F2O/c10-8-3-5-1-7(12)2-6(5)4-9(8)11/h3-4H,1-2H2.

What is the InChIKey of 5,6-Difluoro-1H-inden-2(3H)-one?

The InChIKey is FPOCXYWEBBMGFD-UHFFFAOYSA-N.

What is the canonical SMILES of 5,6-Difluoro-1H-inden-2(3H)-one?

The canonical SMILES is C1C(=O)CC2=CC(=C(C=C21)F)F.

What is the CAS number of 5,6-Difluoro-1H-inden-2(3H)-one?

The CAS number is 161712-79-4.

What is the XLogP3-AA value of 5,6-Difluoro-1H-inden-2(3H)-one?

The XLogP3-AA value is 1.5.

How many hydrogen bond acceptors does 5,6-Difluoro-1H-inden-2(3H)-one have?

It has 3 hydrogen bond acceptors.