The molecular formula of the compound is C12H15BN2O2S.
What are the synonyms for the compound?
The synonyms for the compound are 1168135-03-2, 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole, Benzo[c][1,2,5]thiadiazole-5-boronic acid pinacol ester, and benzo[c][1,2,5]thiadiazole-5-boronic acid, pinacol ester.
What is the molecular weight of the compound?
The molecular weight of the compound is 262.14 g/mol.
When was the compound created and last modified?
The compound was created on July 26, 2010, and last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H15BN2O2S/c1-11(2)12(3,4)17-13(16-11)8-5-6-9-10(7-8)15-18-14-9/h5-7H,1-4H3.
What is the InChIKey of the compound?
The InChIKey of the compound is KISHNZJGTMYYKH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC3=NSN=C3C=C2.
What is the CAS number of the compound?
The CAS number of the compound is 1168135-03-2.
How many hydrogen bond acceptors are there in the compound?
There are 5 hydrogen bond acceptors in the compound.
※ Please kindly note that our products are for research use only.