What is the molecular formula of 4-Tolylboronic acid?
The molecular formula of 4-Tolylboronic acid is C7H9BO2.
What is the molecular weight of 4-Tolylboronic acid?
The molecular weight of 4-Tolylboronic acid is 135.96 g/mol.
What is the IUPAC name of 4-Tolylboronic acid?
The IUPAC name of 4-Tolylboronic acid is (4-methylphenyl)boronic acid.
What is the InChI code of 4-Tolylboronic acid?
The InChI code of 4-Tolylboronic acid is InChI=1S/C7H9BO2/c1-6-2-4-7(5-3-6)8(9)10/h2-5,9-10H,1H3.
What is the InChIKey of 4-Tolylboronic acid?
The InChIKey of 4-Tolylboronic acid is BIWQNIMLAISTBV-UHFFFAOYSA-N.
What is the canonical SMILES representation of 4-Tolylboronic acid?
The canonical SMILES representation of 4-Tolylboronic acid is B(C1=CC=C(C=C1)C)(O)O.
What is the CAS number of 4-Tolylboronic acid?
The CAS number of 4-Tolylboronic acid is 5720-05-8.
What is the UNII of 4-Tolylboronic acid?
The UNII of 4-Tolylboronic acid is YJM4GM7K66.
What is the ChEMBL ID of 4-Tolylboronic acid?
The ChEMBL ID of 4-Tolylboronic acid is CHEMBL140780.
Is 4-Tolylboronic acid a canonicalized compound?
Yes, 4-Tolylboronic acid is a canonicalized compound.