What is the molecular formula of 4-Thiophen-2-ylphenol?
The molecular formula is C10H8OS.
What is the molecular weight of 4-Thiophen-2-ylphenol?
The molecular weight is 176.24 g/mol.
What is the IUPAC name of 4-Thiophen-2-ylphenol?
The IUPAC name is 4-thiophen-2-ylphenol.
What is the InChI of 4-Thiophen-2-ylphenol?
The InChI is InChI=1S/C10H8OS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7,11H.
What is the InChIKey of 4-Thiophen-2-ylphenol?
The InChIKey is RUZWJMSQCFYNAM-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Thiophen-2-ylphenol?
The canonical SMILES is C1=CSC(=C1)C2=CC=C(C=C2)O.
What is the CAS number of 4-Thiophen-2-ylphenol?
The CAS number is 29886-65-5.
What is the EC number of 4-Thiophen-2-ylphenol?
The EC number is 636-903-7.
What is the monoisotopic mass of 4-Thiophen-2-ylphenol?
The monoisotopic mass is 176.02958605 g/mol.
Is 4-Thiophen-2-ylphenol a canonical compound?
Yes, it is a canonical compound.